C25H24O7 — CID 634865
[4-[7-acetyloxy-5-methoxy-8-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] acetate (PubChem CID 634865) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is [4-[7-acetyloxy-5-methoxy-8-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] acetate.
| Compound Name | [4-[7-acetyloxy-5-methoxy-8-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 634865 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [4-[7-acetyloxy-5-methoxy-8-(3-methylbut-2-enyl)-4-oxochromen-3-yl]phenyl] acetate |
| SMILES | COc1cc(OC(C)=O)c(CC=C(C)C)c2occ(-c3ccc(OC(C)=O)cc3)c(=O)c12 |
| InChI | InChI=1S/C25H24O7/c1-14(2)6-11-19-21(32-16(4)27)12-22(29-5)23-24(28)20(13-30-25(19)23)17-7-9-18(10-8-17)31-15(3)26/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | MRWZHZFSBOZOKS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|