C22H18O9 — CID 162915533
[4-(5,7-diacetyloxy-6-methoxy-4-oxochromen-3-yl)phenyl] acetate (PubChem CID 162915533) has the molecular formula C22H18O9 and a molecular weight of 426.38 g/mol. Its IUPAC name is [4-(5,7-diacetyloxy-6-methoxy-4-oxochromen-3-yl)phenyl] acetate.
| Compound Name | [4-(5,7-diacetyloxy-6-methoxy-4-oxochromen-3-yl)phenyl] acetate |
|---|---|
| PubChem CID | 162915533 |
| Molecular Formula | C22H18O9 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [4-(5,7-diacetyloxy-6-methoxy-4-oxochromen-3-yl)phenyl] acetate |
| SMILES | COc1c(OC(C)=O)cc2occ(-c3ccc(OC(C)=O)cc3)c(=O)c2c1OC(C)=O |
| InChI | InChI=1S/C22H18O9/c1-11(23)29-15-7-5-14(6-8-15)16-10-28-17-9-18(30-12(2)24)21(27-4)22(31-13(3)25)19(17)20(16)26/h5-10H,1-4H3 |
| InChIKey | GVUMJVGJKBJADS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|