C31H36O10 — CID 132939466
8-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-2-(4-methoxybutyl)-8-oxooctanoic acid (PubChem CID 132939466) has the molecular formula C31H36O10 and a molecular weight of 568.62 g/mol. Its IUPAC name is 8-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-2-(4-methoxybutyl)-8-oxooctanoic acid.
| Compound Name | 8-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-2-(4-methoxybutyl)-8-oxooctanoic acid |
|---|---|
| PubChem CID | 132939466 |
| Molecular Formula | C31H36O10 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 8-[3-(4-acetyloxyphenyl)-6-methoxy-4-oxochromen-7-yl]oxy-2-(4-methoxybutyl)-8-oxooctanoic acid |
| SMILES | COCCCCC(CCCCCC(=O)Oc1cc2occ(-c3ccc(OC(C)=O)cc3)c(=O)c2cc1OC)C(=O)O |
| InChI | InChI=1S/C31H36O10/c1-20(32)40-23-14-12-21(13-15-23)25-19-39-26-18-28(27(38-3)17-24(26)30(25)34)41-29(33)11-6-4-5-9-22(31(35)36)10-7-8-16-37-2/h12-15,17-19,22H,4-11,16H2,1-3H3,(H,35,36) |
| InChIKey | NASWLJLIDGWRRJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|