C33H42O5 — CID 15484321
[4-(7-hydroxy-4-oxochromen-3-yl)phenyl] (Z)-octadec-9-enoate (PubChem CID 15484321) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is [4-(7-hydroxy-4-oxochromen-3-yl)phenyl] (Z)-octadec-9-enoate.
| Compound Name | [4-(7-hydroxy-4-oxochromen-3-yl)phenyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 15484321 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | [4-(7-hydroxy-4-oxochromen-3-yl)phenyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(-c2coc3cc(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C33H42O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-32(35)38-28-21-18-26(19-22-28)30-25-37-31-24-27(34)20-23-29(31)33(30)36/h9-10,18-25,34H,2-8,11-17H2,1H3/b10-9- |
| InChIKey | BESDLUCQLXBDRL-KTKRTIGZSA-N |
| XLogP | 9.11 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|