About [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride
[3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride (PubChem CID 71572195) has the molecular formula C21H22ClNO5
and a molecular weight of 403.86 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride.
Molecular Properties
| Compound Name | [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride |
| PubChem CID | 71572195 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride |
| SMILES | CCN(CC)CC(=O)Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1.Cl |
| InChI | InChI=1S/C21H21NO5.ClH/c1-3-22(4-2)12-20(24)27-16-9-10-17-19(11-16)26-13-18(21(17)25)14-5-7-15(23)8-6-14;/h5-11,13,23H,3-4,12H2,1-2H3;1H |
| InChIKey | JBQAHEMGEWQPQA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride?
The IUPAC name of [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride (CID 71572195) is [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride.
What is the SMILES notation for [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride?
The canonical SMILES for [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride is CCN(CC)CC(=O)Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1.Cl.
What is the InChIKey of [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride?
The InChIKey is JBQAHEMGEWQPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO5.ClH/c1-3-22(4-2)12-20(24)27-16-9-10-17-19(11-16)26-13-18(21(17)25)14-5-7-15(23)8-6-14;/h5-11,13,23H,3-4,12H2,1-2H3;1H.
What are the key properties of [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride?
[3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride has a molecular weight of 403.86 g/mol, XLogP of 3.83, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-hydroxyphenyl)-4-oxochromen-7-yl] 2-(diethylamino)acetate;hydrochloride is sourced from PubChem (CID 71572195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).