C15H10KO7S — CID 169436996
Daidzein 7-Sulfate Potassium Salt (PubChem CID 169436996) has the molecular formula C15H10KO7S and a molecular weight of 373.40 g/mol.
| Compound Name | Daidzein 7-Sulfate Potassium Salt |
|---|---|
| PubChem CID | 169436996 |
| Molecular Formula | C15H10KO7S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | — |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(OS(=O)(=O)O)ccc12.[K] |
| InChI | InChI=1S/C15H10O7S.K/c16-10-3-1-9(2-4-10)13-8-21-14-7-11(22-23(18,19)20)5-6-12(14)15(13)17;/h1-8,16H,(H,18,19,20); |
| InChIKey | KFWINVRUHICRGE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|