C21H18O13S — CID 162817898
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[4-oxo-3-(4-sulfooxyphenyl)chromen-7-yl]oxyoxane-2-carboxylic acid (PubChem CID 162817898) has the molecular formula C21H18O13S and a molecular weight of 510.43 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[4-oxo-3-(4-sulfooxyphenyl)chromen-7-yl]oxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[4-oxo-3-(4-sulfooxyphenyl)chromen-7-yl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162817898 |
| Molecular Formula | C21H18O13S |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[4-oxo-3-(4-sulfooxyphenyl)chromen-7-yl]oxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@H](Oc2ccc3c(=O)c(-c4ccc(OS(=O)(=O)O)cc4)coc3c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O13S/c22-15-12-6-5-11(32-21-18(25)16(23)17(24)19(33-21)20(26)27)7-14(12)31-8-13(15)9-1-3-10(4-2-9)34-35(28,29)30/h1-8,16-19,21,23-25H,(H,26,27)(H,28,29,30)/t16-,17-,18+,19-,21-/m0/s1 |
| InChIKey | GFHHFNZYJNKWPT-UNJWAJPSSA-N |
| XLogP | -0.09 |
| TPSA | 210.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|