C21H20O9 — CID 162818894
3-(4-methoxyphenyl)-7-[(2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxychromen-4-one (PubChem CID 162818894) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-7-[(2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxychromen-4-one.
| Compound Name | 3-(4-methoxyphenyl)-7-[(2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 162818894 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-(4-methoxyphenyl)-7-[(2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]oxychromen-4-one |
| SMILES | COc1ccc(-c2coc3cc(O[C@@H]4O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]4O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C21H20O9/c1-27-11-4-2-10(3-5-11)14-9-28-15-8-12(6-7-13(15)16(14)22)29-21-19(25)17(23)18(24)20(26)30-21/h2-9,17-21,23-26H,1H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | PFZXTEDLZHMKIU-YMQHIKHWSA-N |
| XLogP | 0.60 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |