C21H20O4 — CID 10925737
7-hex-5-enoxy-3-(4-hydroxyphenyl)chromen-4-one (PubChem CID 10925737) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 7-hex-5-enoxy-3-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 7-hex-5-enoxy-3-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 10925737 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 7-hex-5-enoxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | C=CCCCCOc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1 |
| InChI | InChI=1S/C21H20O4/c1-2-3-4-5-12-24-17-10-11-18-20(13-17)25-14-19(21(18)23)15-6-8-16(22)9-7-15/h2,6-11,13-14,22H,1,3-5,12H2 |
| InChIKey | CATCPEKSVNZNNV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|