C26H30O6 — CID 44625222
2-methylpropyl 5-[4-(7-hydroxy-4-oxochromen-3-yl)phenoxy]-2,2-dimethylpentanoate (PubChem CID 44625222) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-methylpropyl 5-[4-(7-hydroxy-4-oxochromen-3-yl)phenoxy]-2,2-dimethylpentanoate.
| Compound Name | 2-methylpropyl 5-[4-(7-hydroxy-4-oxochromen-3-yl)phenoxy]-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 44625222 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-methylpropyl 5-[4-(7-hydroxy-4-oxochromen-3-yl)phenoxy]-2,2-dimethylpentanoate |
| SMILES | CC(C)COC(=O)C(C)(C)CCCOc1ccc(-c2coc3cc(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H30O6/c1-17(2)15-32-25(29)26(3,4)12-5-13-30-20-9-6-18(7-10-20)22-16-31-23-14-19(27)8-11-21(23)24(22)28/h6-11,14,16-17,27H,5,12-13,15H2,1-4H3 |
| InChIKey | OPEVSKFTKJWYOF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|