C16H10O5 — CID 67365953
4-(7-hydroxy-4-oxochromen-3-yl)benzoic acid (PubChem CID 67365953) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is 4-(7-hydroxy-4-oxochromen-3-yl)benzoic acid.
| Compound Name | 4-(7-hydroxy-4-oxochromen-3-yl)benzoic acid |
|---|---|
| PubChem CID | 67365953 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-(7-hydroxy-4-oxochromen-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2coc3cc(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C16H10O5/c17-11-5-6-12-14(7-11)21-8-13(15(12)18)9-1-3-10(4-2-9)16(19)20/h1-8,17H,(H,19,20) |
| InChIKey | CSDZXASRBPOKNC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |