C18H16O6S — CID 10872107
4-(7-hydroxy-4-oxochromen-3-yl)-2-propan-2-ylbenzenesulfonic acid (PubChem CID 10872107) has the molecular formula C18H16O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-(7-hydroxy-4-oxochromen-3-yl)-2-propan-2-ylbenzenesulfonic acid.
| Compound Name | 4-(7-hydroxy-4-oxochromen-3-yl)-2-propan-2-ylbenzenesulfonic acid |
|---|---|
| PubChem CID | 10872107 |
| Molecular Formula | C18H16O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-(7-hydroxy-4-oxochromen-3-yl)-2-propan-2-ylbenzenesulfonic acid |
| SMILES | CC(C)c1cc(-c2coc3cc(O)ccc3c2=O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C18H16O6S/c1-10(2)14-7-11(3-6-17(14)25(21,22)23)15-9-24-16-8-12(19)4-5-13(16)18(15)20/h3-10,19H,1-2H3,(H,21,22,23) |
| InChIKey | BLBSINAUSWHLMQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|