C24H28O3 — CID 11024901
7-hydroxy-3-[2,4,5-tri(propan-2-yl)phenyl]chromen-4-one (PubChem CID 11024901) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 7-hydroxy-3-[2,4,5-tri(propan-2-yl)phenyl]chromen-4-one.
| Compound Name | 7-hydroxy-3-[2,4,5-tri(propan-2-yl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 11024901 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 7-hydroxy-3-[2,4,5-tri(propan-2-yl)phenyl]chromen-4-one |
| SMILES | CC(C)c1cc(C(C)C)c(C(C)C)cc1-c1coc2cc(O)ccc2c1=O |
| InChI | InChI=1S/C24H28O3/c1-13(2)18-10-20(15(5)6)21(11-19(18)14(3)4)22-12-27-23-9-16(25)7-8-17(23)24(22)26/h7-15,25H,1-6H3 |
| InChIKey | XFVXXRIWUCRIJM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |