C17H13BrO5 — CID 69367923
3-(3-bromo-2,5-dimethoxyphenyl)-7-hydroxychromen-4-one (PubChem CID 69367923) has the molecular formula C17H13BrO5 and a molecular weight of 377.19 g/mol. Its IUPAC name is 3-(3-bromo-2,5-dimethoxyphenyl)-7-hydroxychromen-4-one.
| Compound Name | 3-(3-bromo-2,5-dimethoxyphenyl)-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 69367923 |
| Molecular Formula | C17H13BrO5 |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 3-(3-bromo-2,5-dimethoxyphenyl)-7-hydroxychromen-4-one |
| SMILES | COc1cc(Br)c(OC)c(-c2coc3cc(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C17H13BrO5/c1-21-10-6-12(17(22-2)14(18)7-10)13-8-23-15-5-9(19)3-4-11(15)16(13)20/h3-8,19H,1-2H3 |
| InChIKey | BOSPWTUBISYYGL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |