C21H20O7 — CID 5379641
3-[2-[(3,3-dimethyloxiran-2-yl)methyl]-4,6-dihydroxy-3-methoxyphenyl]-7-hydroxychromen-4-one (PubChem CID 5379641) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is 3-[2-[(3,3-dimethyloxiran-2-yl)methyl]-4,6-dihydroxy-3-methoxyphenyl]-7-hydroxychromen-4-one.
| Compound Name | 3-[2-[(3,3-dimethyloxiran-2-yl)methyl]-4,6-dihydroxy-3-methoxyphenyl]-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 5379641 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-[2-[(3,3-dimethyloxiran-2-yl)methyl]-4,6-dihydroxy-3-methoxyphenyl]-7-hydroxychromen-4-one |
| SMILES | COc1c(O)cc(O)c(-c2coc3cc(O)ccc3c2=O)c1CC1OC1(C)C |
| InChI | InChI=1S/C21H20O7/c1-21(2)17(28-21)7-12-18(14(23)8-15(24)20(12)26-3)13-9-27-16-6-10(22)4-5-11(16)19(13)25/h4-6,8-9,17,22-24H,7H2,1-3H3 |
| InChIKey | PSOKATNTSOVVBF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|