C21H18O5 — CID 15139682
7-hydroxy-3-(8-methoxy-2,2-dimethylchromen-6-yl)chromen-4-one (PubChem CID 15139682) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is 7-hydroxy-3-(8-methoxy-2,2-dimethylchromen-6-yl)chromen-4-one.
| Compound Name | 7-hydroxy-3-(8-methoxy-2,2-dimethylchromen-6-yl)chromen-4-one |
|---|---|
| PubChem CID | 15139682 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 7-hydroxy-3-(8-methoxy-2,2-dimethylchromen-6-yl)chromen-4-one |
| SMILES | COc1cc(-c2coc3cc(O)ccc3c2=O)cc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C21H18O5/c1-21(2)7-6-12-8-13(9-18(24-3)20(12)26-21)16-11-25-17-10-14(22)4-5-15(17)19(16)23/h4-11,22H,1-3H3 |
| InChIKey | OKVVENANSYGXCE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |