C20H16O5 — CID 101405688
7-(3,4-dihydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one (PubChem CID 101405688) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 7-(3,4-dihydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one.
| Compound Name | 7-(3,4-dihydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 101405688 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 7-(3,4-dihydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| SMILES | CC1(C)C=Cc2cc3c(=O)c(-c4ccc(O)c(O)c4)coc3cc2O1 |
| InChI | InChI=1S/C20H16O5/c1-20(2)6-5-12-7-13-18(9-17(12)25-20)24-10-14(19(13)23)11-3-4-15(21)16(22)8-11/h3-10,21-22H,1-2H3 |
| InChIKey | VXWVOKWTGVKMOM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|