C26H18O4 — CID 15320936
3,7-bis(4-methylphenyl)pyrano[3,2-g]chromene-4,6-dione (PubChem CID 15320936) has the molecular formula C26H18O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3,7-bis(4-methylphenyl)pyrano[3,2-g]chromene-4,6-dione.
| Compound Name | 3,7-bis(4-methylphenyl)pyrano[3,2-g]chromene-4,6-dione |
|---|---|
| PubChem CID | 15320936 |
| Molecular Formula | C26H18O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3,7-bis(4-methylphenyl)pyrano[3,2-g]chromene-4,6-dione |
| SMILES | Cc1ccc(-c2coc3cc4occ(-c5ccc(C)cc5)c(=O)c4cc3c2=O)cc1 |
| InChI | InChI=1S/C26H18O4/c1-15-3-7-17(8-4-15)21-13-29-23-12-24-20(11-19(23)25(21)27)26(28)22(14-30-24)18-9-5-16(2)6-10-18/h3-14H,1-2H3 |
| InChIKey | AEZFPKZWMYYQEG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|