C17H14O4 — CID 46702269
7-methoxy-3-(4-methoxyphenyl)chromen-4-one (PubChem CID 46702269) has the molecular formula C17H14O4 and a molecular weight of 285.27 g/mol. Its IUPAC name is 7-methoxy-3-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 7-methoxy-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 46702269 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 7-methoxy-3-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-[13c]2[13cH]oc3cc(OC)ccc3[13c]2=O)cc1 |
| InChI | InChI=1S/C17H14O4/c1-19-12-5-3-11(4-6-12)15-10-21-16-9-13(20-2)7-8-14(16)17(15)18/h3-10H,1-2H3/i10+1,15+1,17+1 |
| InChIKey | LPNBCGIVZXHHHO-RNXOINPYSA-N |
| XLogP | 3.48 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |