C26H26O6 — CID 46854087
6-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-5-methoxy-8,8-dimethylpyrano[2,3-h]chromen-4-one (PubChem CID 46854087) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 6-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-5-methoxy-8,8-dimethylpyrano[2,3-h]chromen-4-one.
| Compound Name | 6-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-5-methoxy-8,8-dimethylpyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 46854087 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6-(2-hydroxy-3-methylbut-3-enyl)-3-(4-hydroxyphenyl)-5-methoxy-8,8-dimethylpyrano[2,3-h]chromen-4-one |
| SMILES | C=C(C)C(O)Cc1c2c(c3occ(-c4ccc(O)cc4)c(=O)c3c1OC)C=CC(C)(C)O2 |
| InChI | InChI=1S/C26H26O6/c1-14(2)20(28)12-18-23-17(10-11-26(3,4)32-23)25-21(24(18)30-5)22(29)19(13-31-25)15-6-8-16(27)9-7-15/h6-11,13,20,27-28H,1,12H2,2-5H3 |
| InChIKey | ANTPDOHSTMAJDB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|