C17H15NO6 — CID 142974313
8-(aminomethyl)-5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one (PubChem CID 142974313) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 8-(aminomethyl)-5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one.
| Compound Name | 8-(aminomethyl)-5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
|---|---|
| PubChem CID | 142974313 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 8-(aminomethyl)-5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| SMILES | COc1c(O)c(CN)c2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| InChI | InChI=1S/C17H15NO6/c1-23-17-14(21)10(6-18)16-12(15(17)22)13(20)11(7-24-16)8-2-4-9(19)5-3-8/h2-5,7,19,21-22H,6,18H2,1H3 |
| InChIKey | SBFXEKOSVRXOBL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|