C19H18O5 — CID 135200514
5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylpropyl)chromen-4-one (PubChem CID 135200514) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylpropyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylpropyl)chromen-4-one |
|---|---|
| PubChem CID | 135200514 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(2-methylpropyl)chromen-4-one |
| SMILES | CC(C)Cc1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
| InChI | InChI=1S/C19H18O5/c1-10(2)7-13-15(21)8-16(22)17-18(23)14(9-24-19(13)17)11-3-5-12(20)6-4-11/h3-6,8-10,20-22H,7H2,1-2H3 |
| InChIKey | MGMPSADLSUBHQF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |