C21H18O6 — CID 71825881
5-hydroxy-3-(4-hydroxyphenyl)-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71825881) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 5-hydroxy-3-(4-hydroxyphenyl)-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-3-(4-hydroxyphenyl)-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71825881 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-10-propan-2-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CC(C)C1CC(=O)Oc2cc(O)c3c(=O)c(-c4ccc(O)cc4)coc3c21 |
| InChI | InChI=1S/C21H18O6/c1-10(2)13-7-17(24)27-16-8-15(23)19-20(25)14(9-26-21(19)18(13)16)11-3-5-12(22)6-4-11/h3-6,8-10,13,22-23H,7H2,1-2H3 |
| InChIKey | FJNQFRAWUCQLMZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|