C21H20O7 — CID 162895992
5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-8-(4-hydroxy-3-methylbut-2-enyl)chromen-4-one (PubChem CID 162895992) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-8-(4-hydroxy-3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-8-(4-hydroxy-3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 162895992 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-8-(4-hydroxy-3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3c(CC=C(C)CO)c(O)cc(O)c3c2=O)cc1O |
| InChI | InChI=1S/C21H20O7/c1-11(9-22)3-5-13-15(23)8-17(25)19-20(26)14(10-28-21(13)19)12-4-6-18(27-2)16(24)7-12/h3-4,6-8,10,22-25H,5,9H2,1-2H3 |
| InChIKey | UCKSAYIMWMIZQJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|