About 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one
5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one (PubChem CID 6708795) has the molecular formula C18H16O6
and a molecular weight of 328.32 g/mol. Its IUPAC name is 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
| PubChem CID | 6708795 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3c(OC)c(OC)cc(O)c3c2=O)cc1 |
| InChI | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)12-9-24-18-15(16(12)20)13(19)8-14(22-2)17(18)23-3/h4-9,19H,1-3H3 |
| InChIKey | WVKDAMAQNQRJFP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one?
The IUPAC name of 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one (CID 6708795) is 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one.
What is the SMILES notation for 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one?
The canonical SMILES for 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one is COc1ccc(-c2coc3c(OC)c(OC)cc(O)c3c2=O)cc1.
What is the InChIKey of 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one?
The InChIKey is WVKDAMAQNQRJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)12-9-24-18-15(16(12)20)13(19)8-14(22-2)17(18)23-3/h4-9,19H,1-3H3.
What are the key properties of 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one?
5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one has a molecular weight of 328.32 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-7,8-dimethoxy-3-(4-methoxyphenyl)chromen-4-one is sourced from PubChem (CID 6708795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).