C19H19NO6 — CID 90823287
5,7-dihydroxy-6-methoxy-3-(4-methoxyphenyl)-8-(methylaminomethyl)chromen-4-one (PubChem CID 90823287) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 5,7-dihydroxy-6-methoxy-3-(4-methoxyphenyl)-8-(methylaminomethyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-6-methoxy-3-(4-methoxyphenyl)-8-(methylaminomethyl)chromen-4-one |
|---|---|
| PubChem CID | 90823287 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5,7-dihydroxy-6-methoxy-3-(4-methoxyphenyl)-8-(methylaminomethyl)chromen-4-one |
| SMILES | CNCc1c(O)c(OC)c(O)c2c(=O)c(-c3ccc(OC)cc3)coc12 |
| InChI | InChI=1S/C19H19NO6/c1-20-8-12-16(22)19(25-3)17(23)14-15(21)13(9-26-18(12)14)10-4-6-11(24-2)7-5-10/h4-7,9,20,22-23H,8H2,1-3H3 |
| InChIKey | PDFSSALGOWJPNP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|