C20H20O6 — CID 46840811
7-ethoxy-3-(4-ethoxyphenyl)-5-hydroxy-6-methoxychromen-4-one (PubChem CID 46840811) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is 7-ethoxy-3-(4-ethoxyphenyl)-5-hydroxy-6-methoxychromen-4-one.
| Compound Name | 7-ethoxy-3-(4-ethoxyphenyl)-5-hydroxy-6-methoxychromen-4-one |
|---|---|
| PubChem CID | 46840811 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 7-ethoxy-3-(4-ethoxyphenyl)-5-hydroxy-6-methoxychromen-4-one |
| SMILES | CCOc1ccc(-c2coc3cc(OCC)c(OC)c(O)c3c2=O)cc1 |
| InChI | InChI=1S/C20H20O6/c1-4-24-13-8-6-12(7-9-13)14-11-26-15-10-16(25-5-2)20(23-3)19(22)17(15)18(14)21/h6-11,22H,4-5H2,1-3H3 |
| InChIKey | HJRYQCFFMCQKTC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |