C17H14O6 — CID 5491550
5-hydroxy-3-(2-hydroxyphenyl)-6,7-dimethoxychromen-4-one (PubChem CID 5491550) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is 5-hydroxy-3-(2-hydroxyphenyl)-6,7-dimethoxychromen-4-one.
| Compound Name | 5-hydroxy-3-(2-hydroxyphenyl)-6,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 5491550 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-hydroxy-3-(2-hydroxyphenyl)-6,7-dimethoxychromen-4-one |
| SMILES | COc1cc2occ(-c3ccccc3O)c(=O)c2c(O)c1OC |
| InChI | InChI=1S/C17H14O6/c1-21-13-7-12-14(16(20)17(13)22-2)15(19)10(8-23-12)9-5-3-4-6-11(9)18/h3-8,18,20H,1-2H3 |
| InChIKey | HVYFRUIBILXVBU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |