About 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one
3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 46879792) has the molecular formula C16H12O7
and a molecular weight of 316.27 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one.
Molecular Properties
| Compound Name | 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one |
| PubChem CID | 46879792 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | COc1c(O)ccc(-c2coc3cc(O)cc(O)c3c2=O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-16-10(18)3-2-8(15(16)21)9-6-23-12-5-7(17)4-11(19)13(12)14(9)20/h2-6,17-19,21H,1H3 |
| InChIKey | SIWJGAYTMXOGHW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one?
The IUPAC name of 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one (CID 46879792) is 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one.
What is the SMILES notation for 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one?
The canonical SMILES for 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one is COc1c(O)ccc(-c2coc3cc(O)cc(O)c3c2=O)c1O.
What is the InChIKey of 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one?
The InChIKey is SIWJGAYTMXOGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O7/c1-22-16-10(18)3-2-8(15(16)21)9-6-23-12-5-7(17)4-11(19)13(12)14(9)20/h2-6,17-19,21H,1H3.
What are the key properties of 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one?
3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one has a molecular weight of 316.27 g/mol, XLogP of 2.29, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dihydroxy-3-methoxyphenyl)-5,7-dihydroxychromen-4-one is sourced from PubChem (CID 46879792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).