C16H13NO5 — CID 70652570
3-(4-aminophenyl)-5,7-dihydroxy-8-methoxychromen-4-one (PubChem CID 70652570) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-(4-aminophenyl)-5,7-dihydroxy-8-methoxychromen-4-one.
| Compound Name | 3-(4-aminophenyl)-5,7-dihydroxy-8-methoxychromen-4-one |
|---|---|
| PubChem CID | 70652570 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(4-aminophenyl)-5,7-dihydroxy-8-methoxychromen-4-one |
| SMILES | COc1c(O)cc(O)c2c(=O)c(-c3ccc(N)cc3)coc12 |
| InChI | InChI=1S/C16H13NO5/c1-21-15-12(19)6-11(18)13-14(20)10(7-22-16(13)15)8-2-4-9(17)5-3-8/h2-7,18-19H,17H2,1H3 |
| InChIKey | ZFFNYKUEJOXHMW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|