C16H11O8- — CID 25201769
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-olate (PubChem CID 25201769) has the molecular formula C16H11O8- and a molecular weight of 331.26 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-olate.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-olate |
|---|---|
| PubChem CID | 25201769 |
| Molecular Formula | C16H11O8- |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-olate |
| SMILES | COc1c(O)cc(O)c2c(=O)c([O-])c(-c3ccc(O)c(O)c3)oc12 |
| InChI | InChI=1S/C16H12O8/c1-23-15-10(20)5-9(19)11-12(21)13(22)14(24-16(11)15)6-2-3-7(17)8(18)4-6/h2-5,17-20,22H,1H3/p-1 |
| InChIKey | ZASFHSAGASJGRN-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|