C23H22O9 — CID 74978560
[2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-yl] 2-methylbut-2-enoate (PubChem CID 74978560) has the molecular formula C23H22O9 and a molecular weight of 442.42 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-yl] 2-methylbut-2-enoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 74978560 |
| Molecular Formula | C23H22O9 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-5,7-dihydroxy-8-methoxy-4-oxochromen-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)Oc1c(-c2ccc(OC)c(OC)c2)oc2c(OC)c(O)cc(O)c2c1=O |
| InChI | InChI=1S/C23H22O9/c1-6-11(2)23(27)32-22-18(26)17-13(24)10-14(25)20(30-5)21(17)31-19(22)12-7-8-15(28-3)16(9-12)29-4/h6-10,24-25H,1-5H3 |
| InChIKey | NSTVGBOIHUUJLX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|