C21H18O7 — CID 14583402
(5,7-dihydroxy-3-methoxy-4-oxo-2-phenylchromen-8-yl) (Z)-2-methylbut-2-enoate (PubChem CID 14583402) has the molecular formula C21H18O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is (5,7-dihydroxy-3-methoxy-4-oxo-2-phenylchromen-8-yl) (Z)-2-methylbut-2-enoate.
| Compound Name | (5,7-dihydroxy-3-methoxy-4-oxo-2-phenylchromen-8-yl) (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 14583402 |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (5,7-dihydroxy-3-methoxy-4-oxo-2-phenylchromen-8-yl) (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)Oc1c(O)cc(O)c2c(=O)c(OC)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C21H18O7/c1-4-11(2)21(25)28-18-14(23)10-13(22)15-16(24)20(26-3)17(27-19(15)18)12-8-6-5-7-9-12/h4-10,22-23H,1-3H3/b11-4- |
| InChIKey | RRKFFDGUNSJFHI-WCIBSUBMSA-N |
| XLogP | 3.75 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|