C21H19BrO5 — CID 71660987
2-(4-bromophenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 71660987) has the molecular formula C21H19BrO5 and a molecular weight of 431.28 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-(4-bromophenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 71660987 |
| Molecular Formula | C21H19BrO5 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-(4-bromophenyl)-5,7-dihydroxy-3-methoxy-8-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1c(-c2ccc(Br)cc2)oc2c(CC=C(C)C)c(O)cc(O)c2c1=O |
| InChI | InChI=1S/C21H19BrO5/c1-11(2)4-9-14-15(23)10-16(24)17-18(25)21(26-3)19(27-20(14)17)12-5-7-13(22)8-6-12/h4-8,10,23-24H,9H2,1-3H3 |
| InChIKey | CCWSKQYZWJTXBK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|