C27H29FO6 — CID 57405210
2-(4-fluoro-3-methoxyphenyl)-5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one (PubChem CID 57405210) has the molecular formula C27H29FO6 and a molecular weight of 468.52 g/mol. Its IUPAC name is 2-(4-fluoro-3-methoxyphenyl)-5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-(4-fluoro-3-methoxyphenyl)-5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 57405210 |
| Molecular Formula | C27H29FO6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-(4-fluoro-3-methoxyphenyl)-5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c3c(=O)c2OC)ccc1F |
| InChI | InChI=1S/C27H29FO6/c1-14(2)7-10-17-22(29)18(11-8-15(3)4)26-21(23(17)30)24(31)27(33-6)25(34-26)16-9-12-19(28)20(13-16)32-5/h7-9,12-13,29-30H,10-11H2,1-6H3 |
| InChIKey | SZLSKNBIWOZTFD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|