C20H24O5 — CID 141445639
5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one (PubChem CID 141445639) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 141445639 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1coc2c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c2c1=O |
| InChI | InChI=1S/C20H24O5/c1-11(2)6-8-13-17(21)14(9-7-12(3)4)20-16(18(13)22)19(23)15(24-5)10-25-20/h6-7,10,21-22H,8-9H2,1-5H3 |
| InChIKey | OABOHEOSOSBPAB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|