C29H32O7 — CID 57406955
4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]-2-ethylbenzoic acid (PubChem CID 57406955) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]-2-ethylbenzoic acid.
| Compound Name | 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]-2-ethylbenzoic acid |
|---|---|
| PubChem CID | 57406955 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-[5,7-dihydroxy-3-methoxy-6,8-bis(3-methylbut-2-enyl)-4-oxochromen-2-yl]-2-ethylbenzoic acid |
| SMILES | CCc1cc(-c2oc3c(CC=C(C)C)c(O)c(CC=C(C)C)c(O)c3c(=O)c2OC)ccc1C(=O)O |
| InChI | InChI=1S/C29H32O7/c1-7-17-14-18(10-13-19(17)29(33)34)26-28(35-6)25(32)22-24(31)20(11-8-15(2)3)23(30)21(27(22)36-26)12-9-16(4)5/h8-10,13-14,30-31H,7,11-12H2,1-6H3,(H,33,34) |
| InChIKey | KCIYRSIRXQUROL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|