C29H28O10 — CID 122181133
(E)-4-[3-[(E)-3-carboxyprop-2-enoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxybut-2-enoic acid (PubChem CID 122181133) has the molecular formula C29H28O10 and a molecular weight of 536.53 g/mol. Its IUPAC name is (E)-4-[3-[(E)-3-carboxyprop-2-enoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxybut-2-enoic acid.
| Compound Name | (E)-4-[3-[(E)-3-carboxyprop-2-enoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 122181133 |
| Molecular Formula | C29H28O10 |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (E)-4-[3-[(E)-3-carboxyprop-2-enoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxybut-2-enoic acid |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(OC/C=C/C(=O)O)cc(O)c3c(=O)c2OC/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C29H28O10/c1-17(2)8-13-20-22(37-14-4-6-23(31)32)16-21(30)25-26(35)29(38-15-5-7-24(33)34)27(39-28(20)25)18-9-11-19(36-3)12-10-18/h4-12,16,30H,13-15H2,1-3H3,(H,31,32)(H,33,34)/b6-4+,7-5+ |
| InChIKey | YGLNOUYNBIHEDR-YDFGWWAZSA-N |
| XLogP | 4.72 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|