C35H40O14 — CID 122180873
4-[3-[3-[3-(3-carboxypropanoyloxy)propoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxypropoxy]-4-oxobutanoic acid (PubChem CID 122180873) has the molecular formula C35H40O14 and a molecular weight of 684.69 g/mol. Its IUPAC name is 4-[3-[3-[3-(3-carboxypropanoyloxy)propoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxypropoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-[3-[3-(3-carboxypropanoyloxy)propoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxypropoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 122180873 |
| Molecular Formula | C35H40O14 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | 4-[3-[3-[3-(3-carboxypropanoyloxy)propoxy]-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-4-oxochromen-7-yl]oxypropoxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(OCCCOC(=O)CCC(=O)O)cc(O)c3c(=O)c2OCCCOC(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C35H40O14/c1-21(2)6-11-24-26(45-16-4-17-46-29(41)14-12-27(37)38)20-25(36)31-32(43)35(48-19-5-18-47-30(42)15-13-28(39)40)33(49-34(24)31)22-7-9-23(44-3)10-8-22/h6-10,20,36H,4-5,11-19H2,1-3H3,(H,37,38)(H,39,40) |
| InChIKey | MJNLTKIIPMLVQO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 205.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|