C32H33NO11 — CID 155404595
4-O-[7-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-5-nitroso-4-oxochromen-3-yl] 1-O-[2-(2-prop-2-ynoxyethoxy)ethyl] butanedioate (PubChem CID 155404595) has the molecular formula C32H33NO11 and a molecular weight of 607.61 g/mol. Its IUPAC name is 4-O-[7-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-5-nitroso-4-oxochromen-3-yl] 1-O-[2-(2-prop-2-ynoxyethoxy)ethyl] butanedioate.
| Compound Name | 4-O-[7-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-5-nitroso-4-oxochromen-3-yl] 1-O-[2-(2-prop-2-ynoxyethoxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 155404595 |
| Molecular Formula | C32H33NO11 |
| Molecular Weight | 607.61 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | 4-O-[7-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)-5-nitroso-4-oxochromen-3-yl] 1-O-[2-(2-prop-2-ynoxyethoxy)ethyl] butanedioate |
| SMILES | C#CCOCCOCCOC(=O)CCC(=O)Oc1c(-c2ccc(OC)cc2)oc2c(CC=C(C)C)c(O)cc(N=O)c2c1=O |
| InChI | InChI=1S/C32H33NO11/c1-5-14-40-15-16-41-17-18-42-26(35)12-13-27(36)43-32-29(37)28-24(33-38)19-25(34)23(11-6-20(2)3)31(28)44-30(32)21-7-9-22(39-4)10-8-21/h1,6-10,19,34H,11-18H2,2-4H3 |
| InChIKey | MYQGOUBNQQDAND-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 160.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|