C23H24O6 — CID 24880410
7-hydroxy-3,5-dimethoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 24880410) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 7-hydroxy-3,5-dimethoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 7-hydroxy-3,5-dimethoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 24880410 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 7-hydroxy-3,5-dimethoxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(O)cc(OC)c3c(=O)c2OC)cc1 |
| InChI | InChI=1S/C23H24O6/c1-13(2)6-11-16-17(24)12-18(27-4)19-20(25)23(28-5)21(29-22(16)19)14-7-9-15(26-3)10-8-14/h6-10,12,24H,11H2,1-5H3 |
| InChIKey | OAAUCVGXENGDCA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|