C23H24O7 — CID 44562556
5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 44562556) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 44562556 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O)c(CC=C(C)C)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24O7/c1-12(2)6-7-14-15(24)10-16(25)21-17(26)11-18(30-22(14)21)13-8-19(27-3)23(29-5)20(9-13)28-4/h6,8-11,24-25H,7H2,1-5H3 |
| InChIKey | FAIUAVJQNKKQFB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|