About 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid
2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid (PubChem CID 23212601) has the molecular formula C21H18O8
and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid |
| PubChem CID | 23212601 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid |
| SMILES | C=CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(OC)c(OCC(=O)O)c3)oc12 |
| InChI | InChI=1S/C21H18O8/c1-3-4-12-13(22)8-14(23)20-15(24)9-17(29-21(12)20)11-5-6-16(27-2)18(7-11)28-10-19(25)26/h3,5-9,22-23H,1,4,10H2,2H3,(H,25,26) |
| InChIKey | IYFZVWLQDHNWOL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid?
The IUPAC name of 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid (CID 23212601) is 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid.
What is the SMILES notation for 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid?
The canonical SMILES for 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid is C=CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(OC)c(OCC(=O)O)c3)oc12.
What is the InChIKey of 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid?
The InChIKey is IYFZVWLQDHNWOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O8/c1-3-4-12-13(22)8-14(23)20-15(24)9-17(29-21(12)20)11-5-6-16(27-2)18(7-11)28-10-19(25)26/h3,5-9,22-23H,1,4,10H2,2H3,(H,25,26).
What are the key properties of 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid?
2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid has a molecular weight of 398.37 g/mol, XLogP of 3.07, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid is sourced from PubChem (CID 23212601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).