C21H18O8 — CID 23212601
2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid (PubChem CID 23212601) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 23212601 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[5-(5,7-dihydroxy-4-oxo-8-prop-2-enylchromen-2-yl)-2-methoxyphenoxy]acetic acid |
| SMILES | C=CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(OC)c(OCC(=O)O)c3)oc12 |
| InChI | InChI=1S/C21H18O8/c1-3-4-12-13(22)8-14(23)20-15(24)9-17(29-21(12)20)11-5-6-16(27-2)18(7-11)28-10-19(25)26/h3,5-9,22-23H,1,4,10H2,2H3,(H,25,26) |
| InChIKey | IYFZVWLQDHNWOL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|