C17H14O5 — CID 20824988
1,3-dihydroxy-5-methoxy-4-prop-2-enylxanthen-9-one (PubChem CID 20824988) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 1,3-dihydroxy-5-methoxy-4-prop-2-enylxanthen-9-one.
| Compound Name | 1,3-dihydroxy-5-methoxy-4-prop-2-enylxanthen-9-one |
|---|---|
| PubChem CID | 20824988 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1,3-dihydroxy-5-methoxy-4-prop-2-enylxanthen-9-one |
| SMILES | C=CCc1c(O)cc(O)c2c(=O)c3cccc(OC)c3oc12 |
| InChI | InChI=1S/C17H14O5/c1-3-5-9-11(18)8-12(19)14-15(20)10-6-4-7-13(21-2)16(10)22-17(9)14/h3-4,6-8,18-19H,1,5H2,2H3 |
| InChIKey | QJBWCUOWFNIQRA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|