C20H20O7 — CID 11280195
2,3,4,5-tetramethoxy-1-prop-2-enoxyxanthen-9-one (PubChem CID 11280195) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 2,3,4,5-tetramethoxy-1-prop-2-enoxyxanthen-9-one.
| Compound Name | 2,3,4,5-tetramethoxy-1-prop-2-enoxyxanthen-9-one |
|---|---|
| PubChem CID | 11280195 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2,3,4,5-tetramethoxy-1-prop-2-enoxyxanthen-9-one |
| SMILES | C=CCOc1c(OC)c(OC)c(OC)c2oc3c(OC)cccc3c(=O)c12 |
| InChI | InChI=1S/C20H20O7/c1-6-10-26-16-13-14(21)11-8-7-9-12(22-2)15(11)27-17(13)19(24-4)20(25-5)18(16)23-3/h6-9H,1,10H2,2-5H3 |
| InChIKey | CPHMOKUWKAEDIF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|