C20H18O5 — CID 71334079
5-methoxy-1,3-bis(prop-2-enoxy)xanthen-9-one (PubChem CID 71334079) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 5-methoxy-1,3-bis(prop-2-enoxy)xanthen-9-one.
| Compound Name | 5-methoxy-1,3-bis(prop-2-enoxy)xanthen-9-one |
|---|---|
| PubChem CID | 71334079 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-methoxy-1,3-bis(prop-2-enoxy)xanthen-9-one |
| SMILES | C=CCOc1cc(OCC=C)c2c(=O)c3cccc(OC)c3oc2c1 |
| InChI | InChI=1S/C20H18O5/c1-4-9-23-13-11-16(24-10-5-2)18-17(12-13)25-20-14(19(18)21)7-6-8-15(20)22-3/h4-8,11-12H,1-2,9-10H2,3H3 |
| InChIKey | QUCMZUNPNBTJSK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|