C14H10O5 — CID 5281651
1,5-dihydroxy-3-methoxyxanthen-9-one (PubChem CID 5281651) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is 1,5-dihydroxy-3-methoxyxanthen-9-one.
| Compound Name | 1,5-dihydroxy-3-methoxyxanthen-9-one |
|---|---|
| PubChem CID | 5281651 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1,5-dihydroxy-3-methoxyxanthen-9-one |
| SMILES | COc1cc(O)c2c(=O)c3cccc(O)c3oc2c1 |
| InChI | InChI=1S/C14H10O5/c1-18-7-5-10(16)12-11(6-7)19-14-8(13(12)17)3-2-4-9(14)15/h2-6,15-16H,1H3 |
| InChIKey | IQIGECASJMDDMD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|