C17H16O8 — CID 5487631
1,8-dihydroxy-2,3,4,6-tetramethoxyxanthen-9-one (PubChem CID 5487631) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 1,8-dihydroxy-2,3,4,6-tetramethoxyxanthen-9-one.
| Compound Name | 1,8-dihydroxy-2,3,4,6-tetramethoxyxanthen-9-one |
|---|---|
| PubChem CID | 5487631 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1,8-dihydroxy-2,3,4,6-tetramethoxyxanthen-9-one |
| SMILES | COc1cc(O)c2c(=O)c3c(O)c(OC)c(OC)c(OC)c3oc2c1 |
| InChI | InChI=1S/C17H16O8/c1-21-7-5-8(18)10-9(6-7)25-14-11(12(10)19)13(20)15(22-2)17(24-4)16(14)23-3/h5-6,18,20H,1-4H3 |
| InChIKey | PFIUFQOJAPBLTQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|