C17H16O7 — CID 11186597
1,6-dihydroxy-2,3,4-trimethoxy-8-methylxanthen-9-one (PubChem CID 11186597) has the molecular formula C17H16O7 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1,6-dihydroxy-2,3,4-trimethoxy-8-methylxanthen-9-one.
| Compound Name | 1,6-dihydroxy-2,3,4-trimethoxy-8-methylxanthen-9-one |
|---|---|
| PubChem CID | 11186597 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1,6-dihydroxy-2,3,4-trimethoxy-8-methylxanthen-9-one |
| SMILES | COc1c(OC)c(O)c2c(=O)c3c(C)cc(O)cc3oc2c1OC |
| InChI | InChI=1S/C17H16O7/c1-7-5-8(18)6-9-10(7)12(19)11-13(20)15(21-2)17(23-4)16(22-3)14(11)24-9/h5-6,18,20H,1-4H3 |
| InChIKey | WCLGXYKABCIDCB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|