C25H24O10 — CID 10458028
[3-acetyloxy-5-[(E)-2-(5-hydroxy-6,7,8-trimethoxy-3-methyl-4-oxochromen-2-yl)ethenyl]phenyl] acetate (PubChem CID 10458028) has the molecular formula C25H24O10 and a molecular weight of 484.46 g/mol. Its IUPAC name is [3-acetyloxy-5-[(E)-2-(5-hydroxy-6,7,8-trimethoxy-3-methyl-4-oxochromen-2-yl)ethenyl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[(E)-2-(5-hydroxy-6,7,8-trimethoxy-3-methyl-4-oxochromen-2-yl)ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 10458028 |
| Molecular Formula | C25H24O10 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [3-acetyloxy-5-[(E)-2-(5-hydroxy-6,7,8-trimethoxy-3-methyl-4-oxochromen-2-yl)ethenyl]phenyl] acetate |
| SMILES | COc1c(OC)c(O)c2c(=O)c(C)c(/C=C/c3cc(OC(C)=O)cc(OC(C)=O)c3)oc2c1OC |
| InChI | InChI=1S/C25H24O10/c1-12-18(8-7-15-9-16(33-13(2)26)11-17(10-15)34-14(3)27)35-22-19(20(12)28)21(29)23(30-4)25(32-6)24(22)31-5/h7-11,29H,1-6H3/b8-7+ |
| InChIKey | XDNKUKQCGIZSCU-BQYQJAHWSA-N |
| XLogP | 3.85 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|